CAS 882513-61-3
:[2,4-dinitro(~13~C_6_)phenyl]hydrazine
Description:
[2,4-Dinitro(13C6)phenyl]hydrazine is a chemical compound characterized by the presence of a hydrazine functional group attached to a phenyl ring that is substituted with two nitro groups at the 2 and 4 positions. The incorporation of the stable isotope carbon-13 (13C) in the phenyl ring indicates that this compound can be used in isotopic labeling studies, particularly in tracing and analyzing metabolic pathways or reaction mechanisms. The nitro groups contribute to the compound's electron-withdrawing properties, which can influence its reactivity and stability. Typically, compounds with nitro substituents exhibit increased acidity and can participate in various chemical reactions, including nucleophilic substitutions and reductions. The hydrazine moiety is known for its potential as a reducing agent and its applications in organic synthesis. Safety considerations are important, as hydrazines and nitro compounds can be hazardous, requiring appropriate handling and storage protocols. Overall, [2,4-dinitro(13C6)phenyl]hydrazine serves as a valuable compound in both research and industrial applications.
Formula:C6H6N4O4
InChI:InChI=1/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2/i1+1,2+1,3+1,4+1,5+1,6+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Dinitrophenylhydrazine-13C6, Stabilized with Water
CAS:Formula:C6H6N4O4Color and Shape:SolidMolecular weight:204.0922
