CAS 882527-39-1

B-[5-(Acetylmethylamino)-1-naphthalenyl]boronic acid

Description:

B-[5-(Acetylmethylamino)-1-naphthalenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including drug development and materials science. The compound features a naphthalene ring substituted with an acetylmethylamino group, contributing to its unique chemical reactivity and potential biological activity. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. Additionally, the compound may exhibit properties such as fluorescence or photostability, depending on its structural configuration. Its solubility and stability in different solvents can vary, influencing its application in research and industry. Overall, B-[5-(Acetylmethylamino)-1-naphthalenyl]boronic acid represents a versatile building block in synthetic chemistry, particularly in the development of pharmaceuticals and advanced materials.

Formula: C₁₃H₁₄BNO₃

InChI: InChI=1S/C13H14BNO3/c1-9(16)15(2)13-8-4-5-10-11(13)6-3-7-12(10)14(17)18/h3-8,17-18H,1-2H3

InChI key: InChIKey=HXSQPKSUVPBVBY-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C)C=1C2=C(C(B(O)O)=CC=C2)C=CC1

Synonyms:

• Boronic acid, B-[5-(acetylmethylamino)-1-naphthalenyl]-
• [5-(N-Methylacetamido)naphthalen-1-yl]boronic acid
• Boronic acid, [5-(acetylmethylamino)-1-naphthalenyl]-
• B-[5-(Acetylmethylamino)-1-naphthalenyl]boronic acid

Boronic acid, B-[5-(acetylmethylamino)-1-naphthalenyl]-

CAS: 882527-39-1

Formula: C₁₃H₁₄BNO₃

Molecular weight: 243.0662

Ref: IN-DA01QNZ5