CAS 882532-15-2

5-Chloro-3-methyl-1-(2-propen-1-yl)-1H-pyrazol-4-amine

Description:

5-Chloro-3-methyl-1-(2-propen-1-yl)-1H-pyrazol-4-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro group at the 5-position and a methyl group at the 3-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The 1-(2-propen-1-yl) substituent indicates the presence of a vinyl group, which can participate in further chemical reactions, such as polymerization or cross-coupling reactions. This compound may exhibit biological activity, making it of interest for medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, and its properties can be influenced by the presence of functional groups. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions under which it is used. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₇H₁₀ClN₃

InChI: InChI=1S/C7H10ClN3/c1-3-4-11-7(8)6(9)5(2)10-11/h3H,1,4,9H2,2H3

InChI key: InChIKey=WMYOEDYDCVPGKT-UHFFFAOYSA-N

SMILES: C(C=C)N1C(Cl)=C(N)C(C)=N1

Synonyms:

• 1-Allyl-5-chloro-3-methyl-1H-pyrazol-4-amine
• 5-Chloro-3-methyl-1-(2-propen-1-yl)-1H-pyrazol-4-amine
• 1-Allyl-5-chloro-3-methyl-1H-pyrazol-4-ylamine
• 1H-Pyrazol-4-amine, 5-chloro-3-methyl-1-(2-propenyl)-
• 1H-Pyrazol-4-amine, 5-chloro-3-methyl-1-(2-propen-1-yl)-