CAS 88254-71-1

Cyclohexanethione, 2-(3-methyl-2(3H)-benzothiazolylidene)-

Description:

Cyclohexanethione, 2-(3-methyl-2(3H)-benzothiazolylidene)-, is an organic compound characterized by its unique structural features, which include a cyclohexane ring and a thione functional group. The presence of the benzothiazole moiety contributes to its aromatic properties and potential biological activity. This compound typically exhibits a yellow to brown color and may have a distinct odor, characteristic of thiones. It is likely to be soluble in organic solvents, reflecting the non-polar nature of its cyclohexane and aromatic components. The compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the reactivity of the thione group. Its applications could span across fields such as organic synthesis, materials science, or as a potential intermediate in the production of pharmaceuticals. However, specific safety and handling guidelines should be adhered to, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₁₄H₁₅NS₂

InChI: InChI=1S/C14H15NS2/c1-15-11-7-3-5-9-13(11)17-14(15)10-6-2-4-8-12(10)16/h3,5,7,9H,2,4,6,8H2,1H3

InChI key: HJZCLHZOVCMVOL-UHFFFAOYSA-N

SMILES: CN1C2=CC=CC=C2SC1=C3CCCCC3=S

Cyclohexanethione, 2-(3-methyl-2(3H)-benzothiazolylidene)-

CAS: 88254-71-1

Formula: C₁₄H₁₅NS₂

Molecular weight: 261.4056

Ref: IN-DA004CGR