
CAS 88255-07-6
:7-Phenyl-5-heptynoic acid
Description:
7-Phenyl-5-heptynoic acid is an organic compound characterized by its alkyne functional group and a carboxylic acid moiety. It features a seven-carbon chain with a phenyl group attached to the seventh carbon and a triple bond between the fifth and sixth carbons. This structure imparts unique properties, including potential reactivity due to the presence of the alkyne, which can participate in various chemical reactions such as addition reactions. The carboxylic acid group contributes to its acidity and solubility in polar solvents. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, its unique combination of functional groups may allow for further derivatization, expanding its utility in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential reactivity of the alkyne and the corrosive nature of the carboxylic acid.
Formula:C13H14O2
InChI:InChI=1S/C13H14O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,2,7-8,11H2,(H,14,15)
InChI key:InChIKey=ZZIFARXSZVIBOL-UHFFFAOYSA-N
SMILES:C(C#CCCCC(O)=O)C1=CC=CC=C1
Synonyms:- 5-Heptynoic acid, 7-phenyl-
- 7-Phenyl-5-heptynoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
