
CAS 88256-04-6
:1,2,4-Trimethoxy-3-dibenzofuranol
Description:
1,2,4-Trimethoxy-3-dibenzofuranol is an organic compound characterized by its complex molecular structure, which includes a dibenzofuran moiety and three methoxy groups attached to the aromatic system. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, contributing to its potential solubility in organic solvents. The presence of methoxy groups enhances its electron-donating characteristics, which can influence its reactivity and interaction with other chemical species. As a dibenzofuran derivative, it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and pharmacology. The compound's specific melting point, boiling point, and other physical properties would depend on its purity and the conditions under which it is measured. Additionally, its synthesis may involve various organic reactions, including methoxylation and functional group transformations. Overall, 1,2,4-Trimethoxy-3-dibenzofuranol represents a unique structure that could have applications in various fields, including materials science and drug development.
Formula:C15H14O5
InChI:InChI=1S/C15H14O5/c1-17-12-10-8-6-4-5-7-9(8)20-13(10)15(19-3)11(16)14(12)18-2/h4-7,16H,1-3H3
InChI key:InChIKey=XLCIGBDZQKRLPH-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C(O)=C1OC)OC=3C2=CC=CC3
Synonyms:- β-Pyrufuran
- 3-Dibenzofuranol, 1,2,4-trimethoxy-
- 1,2,4-Trimethoxy-3-dibenzofuranol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
