CymitQuimica logo

CAS 88256-05-7

:

1,3,4-Trimethoxy-2-dibenzofuranol

Description:
1,3,4-Trimethoxy-2-dibenzofuranol is a chemical compound characterized by its complex structure, which includes a dibenzofuran moiety and three methoxy groups attached to the aromatic system. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on the specific functional groups present. The presence of methoxy groups can influence its reactivity and polarity, potentially enhancing its solubility in non-polar solvents while making it less soluble in polar solvents. Additionally, the dibenzofuran structure may impart unique optical and electronic properties, making it of interest in various fields, including organic synthesis and materials science. The compound's potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and stability. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, 1,3,4-Trimethoxy-2-dibenzofuranol represents a fascinating subject for further research and application in chemical sciences.
Formula:C15H14O5
InChI:InChI=1S/C15H14O5/c1-17-12-10-8-6-4-5-7-9(8)20-13(10)15(19-3)14(18-2)11(12)16/h4-7,16H,1-3H3
InChI key:InChIKey=LZNMTWGKSPOPIR-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C(OC)=C1O)OC=3C2=CC=CC3
Synonyms:
  • 2-Dibenzofuranol, 1,3,4-trimethoxy-
  • α-Pyrufuran
  • 1,3,4-Trimethoxy-2-dibenzofuranol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.