CymitQuimica logo

CAS 882562-65-4

:

3-(2,5-Dichloro-4-pyrimidinyl)imidazo[1,2-a]pyridine

Description:
3-(2,5-Dichloro-4-pyrimidinyl)imidazo[1,2-a]pyridine is a chemical compound characterized by its complex heterocyclic structure, which includes both imidazole and pyridine rings. This compound features two chlorine substituents on the pyrimidine ring, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the imidazo and pyrimidine moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's molecular structure may influence its interactions with biological targets, making it of interest in drug discovery and development. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. As with many heterocyclic compounds, it may also exhibit interesting electronic properties, which could be explored in various chemical applications.
Formula:C11H6Cl2N4
InChI:InChI=1S/C11H6Cl2N4/c12-7-5-15-11(13)16-10(7)8-6-14-9-3-1-2-4-17(8)9/h1-6H
InChI key:InChIKey=NFTFQMGUXXQFDW-UHFFFAOYSA-N
SMILES:ClC=1C(C=2N3C(=NC2)C=CC=C3)=NC(Cl)=NC1
Synonyms:
  • Imidazo[1,2-a]pyridine, 3-(2,5-dichloro-4-pyrimidinyl)-
  • 3-(2,5-Dichloro-4-pyrimidinyl)imidazo[1,2-a]pyridine
  • 3-(2,5-Dichloropyrimidin-4-yl)imidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.