CAS 88257-34-5

4-Chloro-4,4-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-1,3-butanedione

Description:

4-Chloro-4,4-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-1,3-butanedione, with CAS number 88257-34-5, is a synthetic organic compound characterized by its complex fluorinated structure. This compound features a butanedione backbone, which is a diketone, and is heavily substituted with multiple fluorine atoms, contributing to its unique chemical properties. The presence of the chloro group and the pentafluorophenyl moiety enhances its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The fluorine atoms increase the compound's lipophilicity and stability, making it resistant to metabolic degradation. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine and chlorine substituents. Its synthesis typically involves multi-step reactions, and it may be utilized in research related to fluorinated compounds, which are known for their diverse applications in materials science and medicinal chemistry. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds.

Formula: C₁₀H₂ClF₇O₂

InChI: InChI=1S/C10H2ClF7O2/c11-10(17,18)3(20)1-2(19)4-5(12)7(14)9(16)8(15)6(4)13/h1H2

InChI key: InChIKey=UZTJARZTMQLMDV-UHFFFAOYSA-N

SMILES: C(CC(C(Cl)(F)F)=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1F

Synonyms:

• 1,3-Butanedione, 4-chloro-4,4-difluoro-1-(pentafluorophenyl)-
• 1,3-Butanedione, 4-chloro-4,4-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-
• 4-Chloro-4,4-difluoro-1-(2,3,4,5,6-pentafluorophenyl)-1,3-butanedione

1,3-Butanedione, 4-chloro-4,4-difluoro-1-(pentafluorophenyl)-

CAS: 88257-34-5

Formula: C₁₀H₂ClF₇O₂

Molecular weight: 322.5635

Ref: IN-DA004AKL