CymitQuimica logo

CAS 88259-78-3

:

6-(Ethylamino)-3(2H)-pyridazinone

Description:
6-(Ethylamino)-3(2H)-pyridazinone, identified by its CAS number 88259-78-3, is a heterocyclic organic compound featuring a pyridazinone core structure. This compound is characterized by the presence of an ethylamino group at the 6-position of the pyridazinone ring, which contributes to its chemical reactivity and potential biological activity. Pyridazinones are known for their diverse pharmacological properties, including anti-inflammatory and antimicrobial activities. The presence of the ethylamino substituent can enhance solubility and influence the compound's interaction with biological targets. Typically, such compounds may exhibit moderate to high polarity, which can affect their absorption and distribution in biological systems. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the functional groups present. Overall, 6-(Ethylamino)-3(2H)-pyridazinone represents a class of compounds with potential applications in medicinal chemistry and drug development, warranting further investigation into its properties and effects.
Formula:C6H9N3O
InChI:InChI=1S/C6H9N3O/c1-2-7-5-3-4-6(10)9-8-5/h3-4H,2H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=RLNFWFBMYVHVHQ-UHFFFAOYSA-N
SMILES:N(CC)C=1C=CC(=O)NN1
Synonyms:
  • 3(2H)-Pyridazinone, 6-(ethylamino)-
  • 6-(Ethylamino)-3(2H)-pyridazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.