CymitQuimica logo

CAS 88259-81-8

:

6-(2-Propen-1-ylamino)-3(2H)-pyridazinone

Description:
6-(2-Propen-1-ylamino)-3(2H)-pyridazinone, with the CAS number 88259-81-8, is a chemical compound characterized by its pyridazinone core structure, which features a pyridazine ring fused with a carbonyl group and an amino side chain. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The propenylamino substituent contributes to its reactivity, potentially allowing for further chemical modifications or interactions in biological systems. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its structural features suggest potential applications in medicinal chemistry, where the pyridazinone framework is often associated with various pharmacological effects. As with many organic compounds, stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 6-(2-Propen-1-ylamino)-3(2H)-pyridazinone represents a unique structure with potential utility in various chemical and biological contexts.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c1-2-5-8-6-3-4-7(11)10-9-6/h2-4H,1,5H2,(H,8,9)(H,10,11)
InChI key:InChIKey=BPCPRZXFCGCAKM-UHFFFAOYSA-N
SMILES:N(CC=C)C=1C=CC(=O)NN1
Synonyms:
  • 6-(2-Propen-1-ylamino)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 6-(2-propen-1-ylamino)-
  • 3(2H)-Pyridazinone, 6-(2-propenylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.