CAS 88260-06-4

2-Azabicyclo[2.2.1]heptane-3-carboxylic acid

Description:

2-Azabicyclo[2.2.1]heptane-3-carboxylic acid, also known as a bicyclic compound, features a unique bicyclic structure that includes a nitrogen atom within its ring system. This compound is characterized by its azabicyclic framework, which consists of two fused rings, one of which contains a nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. The carboxylic acid functional group at the 3-position enhances its polarity and solubility in polar solvents, making it useful in various chemical applications. The presence of the carboxylic acid group also allows for potential reactivity in esterification and amidation reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug design. Its structural features contribute to its potential as a building block in the synthesis of more complex molecules. Overall, 2-Azabicyclo[2.2.1]heptane-3-carboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₇H₁₁NO₂

InChI: InChI=1S/C7H11NO2/c9-7(10)6-4-1-2-5(3-4)8-6/h4-6,8H,1-3H2,(H,9,10)

InChI key: InChIKey=BMVVXSIHLQYXJJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2CC(N1)CC2

Synonyms:

• 2-azabicyclo(2.2.1)heptane-3-carboxylic acid
• 3-Azabicyclo[2.2.1]heptane-2-carboxylic acid
• 2-Azabicyclo[2.2.1]heptane-3-carboxylic acid

2-azabicyclo[2.2.1]heptane-3-carboxylic acid

CAS: 88260-06-4

Formula: C₇H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 141.1677

Ref: IN-DA008AVT

2-AZABICYCLO[2.2.1]HEPTANE-3-CARBOXYLIC ACID

CAS: 88260-06-4

Formula: C₇H₁₁NO₂

Purity: 95.0%

Molecular weight: 141.17

Ref: 10-F501840

2-Azabicyclo[2.2.1]heptane-3-carboxylic acid

CAS: 88260-06-4

2-Azabicyclo[2.2.1]heptane-3-carboxylic acid (AAV) is an antiviral agent that inhibits the replication of a number of viruses, including HIV and hepatitis C virus. It has been shown to be effective in treating patients with cirrhosis and multigram hepatitis B or C. 2-Azabicyclo[2.2.1]heptane-3-carboxylic acid is structurally similar to other antiviral agents, such as serine protease inhibitors, which are used to treat chronic hepatitis B and C virus infections. This drug has been shown to inhibit the NS3 protease enzyme that is essential for viral replication in vitro and in vivo. 2-Azabicyclo[2.2.1]heptane-3-carboxylic acid also has structural similarity to ester hydrochloride drugs, which are used for the treatment of em

Formula: C₇H₁₁NO₂

Purity: Min. 95%

Molecular weight: 141.17 g/mol

Ref: 3D-NDA26006