CymitQuimica logo

CAS 88260-07-5

:

Methyl 2-azabicyclo[2.2.1]heptane-3-carboxylate

Description:
Methyl 2-azabicyclo[2.2.1]heptane-3-carboxylate, identified by its CAS number 88260-07-5, is a bicyclic compound featuring a nitrogen atom within its structure, which classifies it as a bicyclic amine. This compound is characterized by a bicyclo[2.2.1] framework, which consists of two fused cyclopropane rings and a nitrogen atom, contributing to its unique chemical properties. The presence of a carboxylate group (–COOCH3) indicates that it is an ester, which can influence its reactivity and solubility in various solvents. Methyl 2-azabicyclo[2.2.1]heptane-3-carboxylate is of interest in medicinal chemistry and organic synthesis due to its potential applications in drug development and as an intermediate in the synthesis of other complex molecules. Its structural features may impart specific biological activities, making it a subject of research in pharmacology. As with many nitrogen-containing compounds, it may exhibit basicity and participate in various chemical reactions, including nucleophilic substitutions and acylation.
Formula:C8H13NO2
InChI:InChI=1S/C8H13NO2/c1-11-8(10)7-5-2-3-6(4-5)9-7/h5-7,9H,2-4H2,1H3
InChI key:InChIKey=HPVCCAYXVXMOOP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C2CC(N1)CC2
Synonyms:
  • 2-Azabicyclo[2.2.1]heptane-3-carboxylic acid, methyl ester
  • Methyl 2-azabicyclo[2.2.1]heptane-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.