CAS 88262-37-7

9-(hydroxymethyl)-10-methyl-1,2-dihydroanthracene-1,2-diol

Description:

9-(Hydroxymethyl)-10-methyl-1,2-dihydroanthracene-1,2-diol, with the CAS number 88262-37-7, is an organic compound belonging to the anthracene family. This substance features a polycyclic aromatic hydrocarbon structure, characterized by its fused benzene rings, which contribute to its stability and unique chemical properties. The presence of hydroxymethyl and diol functional groups indicates that it has both alcohol and phenolic characteristics, which can influence its reactivity and solubility in various solvents. Typically, compounds like this may exhibit interesting photophysical properties, making them potential candidates for applications in organic electronics or as intermediates in organic synthesis. Additionally, the hydroxymethyl and methyl substituents can affect the compound's steric and electronic properties, potentially influencing its interactions in biological systems or its behavior in chemical reactions. Overall, this compound's structural features suggest a range of potential applications in materials science and organic chemistry.

Formula: C₁₆H₁₆O₃

InChI: InChI=1/C16H16O3/c1-9-10-4-2-3-5-12(10)13(8-17)15-11(9)6-7-14(18)16(15)19/h2-7,14,16-19H,8H2,1H3

Synonyms:

• 1,2-Anthracenediol, 1,2-dihydro-9-(hydroxymethyl)-10-methyl-

1,2-anthracenediol, 1,2-dihydro-9-(hydroxymethyl)-10-methyl-

CAS: 88262-37-7

Formula: C₁₆H₁₆O₃

Molecular weight: 256.2964

Ref: IN-DA004C04