CAS 88262-46-8
:Ethane, 1,1′,1′′-[(fluoromethylidyne)tris(oxy)]tris[2-fluoro-2,2-dinitro-
Description:
Ethane, 1,1′,1′′-[(fluoromethylidyne)tris(oxy)]tris[2-fluoro-2,2-dinitro-] is a complex chemical compound characterized by its unique molecular structure, which includes multiple functional groups. The presence of fluorine atoms suggests that it may exhibit enhanced reactivity and potential applications in various fields, including pharmaceuticals and materials science. The dinitro groups indicate that the compound may possess explosive properties, making it important to handle with caution. Additionally, the presence of oxygen in the structure implies potential for hydrogen bonding, which can influence its physical properties such as solubility and boiling point. The compound's CAS number, 88262-46-8, allows for precise identification in chemical databases, facilitating research and safety assessments. Overall, this compound's unique characteristics stem from its intricate arrangement of atoms, which contribute to its chemical behavior and potential applications. As with any chemical substance, understanding its properties is crucial for safe handling and utilization in various applications.
Formula:C7H6F4N6O15
InChI:InChI=1S/C7H6F4N6O15/c8-4(12(18)19,13(20)21)1-30-7(11,31-2-5(9,14(22)23)15(24)25)32-3-6(10,16(26)27)17(28)29/h1-3H2
InChI key:InChIKey=YAHKJLIHRRBISA-UHFFFAOYSA-N
SMILES:C(OCC(N(=O)=O)(N(=O)=O)F)(OCC(N(=O)=O)(N(=O)=O)F)(OCC(N(=O)=O)(N(=O)=O)F)F
Synonyms:- Ethane, 1,1′,1′′-[(fluoromethylidyne)tris(oxy)]tris[2-fluoro-2,2-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethane, 1,1',1''-[(fluoromethylidyne)tris(oxy)]tris[2-fluoro-2,2-dinitro-
CAS:Formula:C7H6F4N6O15Molecular weight:490.1474
