CAS 882651-36-7

4-(methylamino)-3-nitro-1,5-naphthyridin-2(1H)-one

Description:

4-(Methylamino)-3-nitro-1,5-naphthyridin-2(1H)-one is a chemical compound characterized by its complex structure, which includes a naphthyridine core substituted with a methylamino group and a nitro group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the nitro and amino functional groups. The methylamino group can influence the compound's solubility and reactivity, while the nitro group may contribute to its potential as a pharmacophore in medicinal chemistry. The presence of the naphthyridine ring system suggests that it may exhibit aromatic characteristics, which can affect its electronic properties and interactions with other molecules. Additionally, this compound may be of interest in research related to drug development, particularly in the context of targeting specific biological pathways or mechanisms. Its CAS number, 882651-36-7, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases.

Formula: C₉H₈N₄O₃

InChI: InChI=1/C9H8N4O3/c1-10-7-6-5(3-2-4-11-6)12-9(14)8(7)13(15)16/h2-4H,1H3,(H2,10,12,14)

SMILES: CNc1c2c(cccn2)nc(c1N(=O)=O)O

Synonyms:

• 1,5-naphthyridin-2(1H)-one, 4-(methylamino)-3-nitro-
• 4-(Methylamino)-3-nitro-1,5-naphthyridin-2(1H)-one