CymitQuimica logo

CAS 882670-90-8

:

6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine

Description:
6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a pyrimidine ring. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry. The N-methyl group enhances its solubility and may influence its biological activity. This compound is often studied for its potential as a pharmaceutical agent, particularly in the context of targeting specific biological pathways or receptors. Its molecular structure suggests that it may exhibit properties such as moderate to high polarity, which can affect its interaction with biological systems. Additionally, the presence of nitrogen atoms in the rings may contribute to hydrogen bonding capabilities, influencing its pharmacokinetic properties. Overall, 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine is of interest in research for its potential therapeutic applications and its role in the development of new chemical entities.
Formula:C8H7BrN4
InChI:InChI=1S/C8H7BrN4/c1-10-8-12-3-5-2-6(9)4-11-7(5)13-8/h2-4H,1H3,(H,10,11,12,13)
InChI key:InChIKey=PLTBADSHGFJXKA-UHFFFAOYSA-N
SMILES:N(C)C1=NC2=C(C=C(Br)C=N2)C=N1
Synonyms:
  • 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine
  • Pyrido[2,3-d]pyrimidin-2-amine, 6-bromo-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.