CAS 882670-93-1
:6-Bromo-2-iodoquinazoline
Description:
6-Bromo-2-iodoquinazoline is a heterocyclic organic compound characterized by the presence of a quinazoline core, which consists of a fused benzene and pyrimidine ring. The compound features bromine and iodine substituents at the 6 and 2 positions, respectively, which can significantly influence its chemical reactivity and biological activity. Typically, compounds like 6-bromo-2-iodoquinazoline exhibit properties such as moderate to high solubility in organic solvents, and their reactivity can be attributed to the presence of halogen atoms, which can participate in various substitution reactions. This compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural characteristics allow for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of halogens can enhance the lipophilicity of the molecule, potentially affecting its bioavailability and distribution in biological systems. Overall, 6-bromo-2-iodoquinazoline represents a versatile scaffold for further chemical modifications and investigations in drug discovery.
Formula:C8H4BrIN2
InChI:InChI=1/C8H4BrIN2/c9-6-1-2-7-5(3-6)4-11-8(10)12-7/h1-4H
SMILES:c1cc2c(cc1Br)cnc(I)n2
Synonyms:- Quinazoline, 6-Bromo-2-Iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
