CAS 882672-05-1

6-Bromo-2-chloroquinazoline

Description:

6-Bromo-2-chloroquinazoline is a heterocyclic compound belonging to the quinazoline family, characterized by a fused bicyclic structure containing both benzene and pyrimidine rings. This compound features a bromine atom at the 6-position and a chlorine atom at the 2-position of the quinazoline ring, which contributes to its unique chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents often enhances the compound's lipophilicity, potentially influencing its pharmacokinetic properties. 6-Bromo-2-chloroquinazoline is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in various research contexts, including studies on cancer, inflammation, and other diseases. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.

Formula: C₈H₄BrClN₂

InChI: InChI=1/C8H4BrClN2/c9-6-1-2-7-5(3-6)4-11-8(10)12-7/h1-4H

SMILES: c1cc2c(cc1Br)cnc(Cl)n2

Synonyms:

• Quinazoline, 6-Bromo-2-Chloro-
• T66 Bn Dnj Cg He
• 6-Bromo-2-chloro-quinazoline

6-bromo-2-chloroquinazoline

CAS: 882672-05-1

Formula: C₈H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.4878

Ref: IN-DA003N3S

6-Bromo-2-chloroquinazoline

CAS: 882672-05-1

6-Bromo-2-chloroquinazoline

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.49g/mol

Ref: 54-OR55165

6-Bromo-2-chloroquinazoline

CAS: 882672-05-1

Formula: C₈H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.49

Ref: 10-F076228