CAS 882679-07-4

Pyrido[2,3-d]pyrimidin-2-amine

Description:

Pyrido[2,3-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. This compound typically exhibits a planar geometry due to the aromatic nature of its rings, which contributes to its stability and potential for engaging in π-π stacking interactions. It is often soluble in polar organic solvents, reflecting its moderate polarity. The presence of an amino group at the 2-position of the pyrimidine ring enhances its reactivity, allowing for various chemical modifications and interactions, particularly in biological systems. Pyrido[2,3-d]pyrimidin-2-amine is of interest in medicinal chemistry due to its potential pharmacological properties, including activity against certain diseases. Its unique structural features may also allow it to act as a ligand in coordination chemistry or as a building block in the synthesis of more complex molecules. Overall, this compound exemplifies the diverse applications of heterocycles in both synthetic and medicinal chemistry.

Formula: C₇H₆N₄

InChI: InChI=1S/C7H6N4/c8-7-10-4-5-2-1-3-9-6(5)11-7/h1-4H,(H2,8,9,10,11)

InChI key: InChIKey=FPYGYIZVZZXXBO-UHFFFAOYSA-N

SMILES: NC1=NC2=C(C=N1)C=CC=N2

Synonyms:

• Pyrido[2,3-d]pyrimidin-2-amine

Pyrido[2,3-d]pyrimidin-2-amine

CAS: 882679-07-4

Formula: C₇H₆N₄

Molecular weight: 146.1493

Ref: IN-DA008AQS

pyrido[2,3-d]pyrimidin-2-amine

CAS: 882679-07-4

Pyrido[2,3-d]pyrimidin-2-amine is a nucleophilic amine that has been synthesized for its antibacterial properties. It inhibits adenosine kinase and thus prevents the phosphorylation of adenosine monophosphate (AMP) to adenosine triphosphate (ATP). The reaction time of pyrido[2,3-d]pyrimidin-2-amine is dependent on the heterocycle present. Pharmacokinetic studies have shown that this chemical is metabolized in the liver by glucuronidation and sulfation.

Formula: C₇H₆N₄

Purity: Min. 95%

Molecular weight: 146.14 g/mol

Ref: 3D-HKB67907