CAS 882679-23-4
:2-Amino-3-iodo-4-methylbenzoic acid
Description:
2-Amino-3-iodo-4-methylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, an iodine atom, and a methyl group. The presence of the amino group (-NH2) indicates that it is a basic compound, while the carboxylic acid group (-COOH) contributes to its acidic properties. The iodine substitution at the 3-position of the benzene ring enhances its reactivity and can influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs or as intermediates in organic synthesis. Additionally, the presence of both electron-donating (amino and methyl) and electron-withdrawing (iodo and carboxylic acid) groups can affect its electronic properties, making it a subject of interest in medicinal chemistry and materials science.
Formula:C8H8INO2
InChI:InChI=1S/C8H8INO2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,10H2,1H3,(H,11,12)
InChI key:InChIKey=KUPHXIFBKAORGY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(I)=C(C)C=C1
Synonyms:- 2-Amino-3-iodo-4-methylbenzoic acid
- Benzoic acid, 2-amino-3-iodo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
