
CAS 882747-27-5
:N-[2-(1H-Indol-3-yl)ethyl]-4-iodobenzenesulfonamide
Description:
N-[2-(1H-Indol-3-yl)ethyl]-4-iodobenzenesulfonamide is a chemical compound characterized by its complex structure, which includes an indole moiety and a sulfonamide group. The presence of the indole ring, a bicyclic structure containing a benzene fused to a pyrrole, contributes to its potential biological activity, particularly in medicinal chemistry. The sulfonamide group is known for its role in various pharmaceutical applications, often exhibiting antibacterial properties. The iodine atom in the para position of the benzene ring can enhance the compound's lipophilicity and influence its interaction with biological targets. This compound may exhibit unique solubility and stability characteristics due to its functional groups, making it of interest in drug design and development. Additionally, its molecular interactions could be studied for potential therapeutic applications, particularly in oncology or neurology, given the biological significance of both indole and sulfonamide derivatives. Overall, this compound represents a fusion of structural features that may lead to diverse pharmacological effects.
Formula:C16H15IN2O2S
InChI:InChI=1S/C16H15IN2O2S/c17-13-5-7-14(8-6-13)22(20,21)19-10-9-12-11-18-16-4-2-1-3-15(12)16/h1-8,11,18-19H,9-10H2
InChI key:InChIKey=QHQODKISMYJRPN-UHFFFAOYSA-N
SMILES:C(CNS(=O)(=O)C1=CC=C(I)C=C1)C=2C=3C(NC2)=CC=CC3
Synonyms:- N-[2-(1H-Indol-3-yl)ethyl]-4-iodobenzenesulfonamide
- Benzenesulfonamide, N-[2-(1H-indol-3-yl)ethyl]-4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.