CymitQuimica logo

CAS 882747-29-7

:

3-Fluoro-α-(1H-indol-3-ylmethylene)-4-(4-morpholinyl)-β-oxobenzenepropanenitrile

Description:
3-Fluoro-α-(1H-indol-3-ylmethylene)-4-(4-morpholinyl)-β-oxobenzenepropanenitrile, with the CAS number 882747-29-7, is a synthetic organic compound characterized by its complex molecular structure, which includes an indole moiety, a morpholine ring, and a nitrile functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the fluorine atom may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the β-oxobenzenepropanenitrile framework suggests potential reactivity and applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its structural features may contribute to specific pharmacological activities, including anti-cancer or anti-inflammatory effects, although detailed biological evaluations would be necessary to confirm such properties. Overall, this compound represents a class of heterocyclic compounds that are often explored for their diverse chemical and biological applications.
Formula:C22H18FN3O2
InChI:InChI=1S/C22H18FN3O2/c23-19-12-15(5-6-21(19)26-7-9-28-10-8-26)22(27)16(13-24)11-17-14-25-20-4-2-1-3-18(17)20/h1-6,11-12,14,25H,7-10H2
InChI key:InChIKey=VHUFKYMDDDFYIS-UHFFFAOYSA-N
SMILES:C(=C(C(=O)C1=CC(F)=C(C=C1)N2CCOCC2)C#N)C=3C=4C(NC3)=CC=CC4
Synonyms:
  • Benzenepropanenitrile, 3-fluoro-α-(1H-indol-3-ylmethylene)-4-(4-morpholinyl)-β-oxo-
  • 3-Fluoro-α-(1H-indol-3-ylmethylene)-4-(4-morpholinyl)-β-oxobenzenepropanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.