CAS 882747-49-1

2,3-Dihydro-4-nitro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one

Description:

2,3-Dihydro-4-nitro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one is a chemical compound characterized by its complex structure, which includes an isoindole core, a nitro group, and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the nitro group may impart additional reactivity and influence its solubility and stability in different solvents. The pyridine ring can contribute to the compound's lipophilicity and may enhance its ability to cross biological membranes. As a result, this compound may be of interest in medicinal chemistry for its potential therapeutic applications. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. Overall, 2,3-Dihydro-4-nitro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one represents a unique structure that may offer insights into new chemical and pharmacological properties.

Formula: C₁₅H₁₃N₃O₃

InChI: InChI=1S/C15H13N3O3/c19-15-12-5-3-6-14(18(20)21)13(12)10-17(15)9-7-11-4-1-2-8-16-11/h1-6,8H,7,9-10H2

InChI key: InChIKey=POCDIACJYCZLQE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C(=O)N(CCC3=CC=CC=N3)C2)=CC=C1

Synonyms:

• 2,3-Dihydro-4-nitro-2-[2-(2-pyridinyl)ethyl]-1H-isoindol-1-one
• 1H-Isoindol-1-one, 2,3-dihydro-4-nitro-2-[2-(2-pyridinyl)ethyl]-