
CAS 882747-67-3
:3-[4-[(2-Thienylsulfonyl)amino]phenoxy]-2-thiophenecarboxylic acid
Description:
3-[4-[(2-Thienylsulfonyl)amino]phenoxy]-2-thiophenecarboxylic acid, with the CAS number 882747-67-3, is a chemical compound characterized by its complex structure that includes a thiophene ring, a phenoxy group, and a sulfonamide moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the thiophene and sulfonamide groups suggests that it may have interesting electronic properties and could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The carboxylic acid functional group can influence its acidity and reactivity, potentially allowing for interactions with biological targets. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and materials science.
Formula:C15H11NO5S3
InChI:InChI=1S/C15H11NO5S3/c17-15(18)14-12(7-9-23-14)21-11-5-3-10(4-6-11)16-24(19,20)13-2-1-8-22-13/h1-9,16H,(H,17,18)
InChI key:InChIKey=JIFASMPLQXMIHO-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)SC=C1)C2=CC=C(NS(=O)(=O)C3=CC=CS3)C=C2
Synonyms:- 2-Thiophenecarboxylic acid, 3-[4-[(2-thienylsulfonyl)amino]phenoxy]-
- 3-[4-[(2-Thienylsulfonyl)amino]phenoxy]-2-thiophenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.