
CAS 882747-71-9
:Methyl 7-[3-(phenylmethoxy)phenyl][1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate
Description:
Methyl 7-[3-(phenylmethoxy)phenyl][1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate, identified by its CAS number 882747-71-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the phenylmethoxy group enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetic properties. As a member of the triazolopyrimidine class, it may exhibit various biological activities, including potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's unique structure allows for interactions with biological targets, making it a subject of interest in drug discovery. Its stability, solubility, and reactivity can be influenced by environmental factors and the presence of functional groups, which are crucial for its application in research and development.
Formula:C20H16N4O3
InChI:InChI=1S/C20H16N4O3/c1-26-19(25)17-11-18(24-20(23-17)21-13-22-24)15-8-5-9-16(10-15)27-12-14-6-3-2-4-7-14/h2-11,13H,12H2,1H3
InChI key:InChIKey=DXGJIZDWEXECLY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(N2C(N1)=NC=N2)C3=CC(OCC4=CC=CC=C4)=CC=C3
Synonyms:- Methyl 7-[3-(phenylmethoxy)phenyl][1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylate
- [1,2,4]Triazolo[1,5-a]pyrimidine-5-carboxylic acid, 7-[3-(phenylmethoxy)phenyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.