CAS 882747-74-2

N-[(2-chlorophenyl)methoxy]-1-[4-(trifluoromethyl)-2-pyridyl]propan-1-imine

Description:

N-[(2-chlorophenyl)methoxy]-1-[4-(trifluoromethyl)-2-pyridyl]propan-1-imine, identified by its CAS number 882747-74-2, is a synthetic organic compound characterized by its complex structure, which includes a methoxy group, a chlorophenyl moiety, and a trifluoromethyl-substituted pyridine. This compound typically exhibits properties associated with imines, such as potential reactivity in nucleophilic addition reactions due to the presence of the imine functional group. The presence of the trifluoromethyl group often enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry. Additionally, the chlorophenyl group may contribute to the compound's electronic properties and steric effects. The overall molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can impart specific biological activities. As with many synthetic compounds, its stability, solubility, and reactivity would depend on environmental conditions and the presence of other reagents.

Formula: C₁₆H₁₄ClF₃N₂O

InChI: InChI=1/C16H14ClF3N2O/c1-2-14(15-9-12(7-8-21-15)16(18,19)20)22-23-10-11-5-3-4-6-13(11)17/h3-9H,2,10H2,1H3/b22-14-

SMILES: CC/C(=N/OCc1ccccc1Cl)/c1cc(ccn1)C(F)(F)F