CAS 882747-79-7

1-[3-(1H-1,2,4-Triazol-1-yl)-5-(trifluoromethyl)-2-pyridinyl]ethanone

Description:

1-[3-(1H-1,2,4-Triazol-1-yl)-5-(trifluoromethyl)-2-pyridinyl]ethanone, with the CAS number 882747-79-7, is a chemical compound characterized by its complex structure, which includes a triazole ring and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological targets. It is often studied for its potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, due to the triazole component, which is known for its role in inhibiting fungal cytochrome P450 enzymes. Additionally, the compound's unique structural features may contribute to its specificity and efficacy in various biochemical pathways. As with many synthetic organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₀H₇F₃N₄O

InChI: InChI=1S/C10H7F3N4O/c1-6(18)9-8(17-5-14-4-16-17)2-7(3-15-9)10(11,12)13/h2-5H,1H3

InChI key: InChIKey=MIQMLXTYGSKPKT-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(C=C(C(F)(F)F)C=N1)N2C=NC=N2

Synonyms:

• Ethanone, 1-[3-(1H-1,2,4-triazol-1-yl)-5-(trifluoromethyl)-2-pyridinyl]-
• 1-[3-(1H-1,2,4-Triazol-1-yl)-5-(trifluoromethyl)-2-pyridinyl]ethanone