CAS 882748-20-1

5,8-Dimethoxy-2-phenyl-3-quinolinecarbonitrile

Description:

5,8-Dimethoxy-2-phenyl-3-quinolinecarbonitrile is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains two methoxy groups (-OCH3) at the 5 and 8 positions of the quinoline ring, contributing to its solubility and reactivity. The presence of a phenyl group at the 2 position enhances its aromatic character and may influence its electronic properties. Additionally, the cyano group (-CN) at the 3 position introduces a polar functional group, which can participate in various chemical reactions, including nucleophilic additions and substitutions. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data and handling precautions should be considered when working with this compound in a laboratory setting.

Formula: C₁₈H₁₄N₂O₂

InChI: InChI=1S/C18H14N2O2/c1-21-15-8-9-16(22-2)18-14(15)10-13(11-19)17(20-18)12-6-4-3-5-7-12/h3-10H,1-2H3

InChI key: InChIKey=AQMMQSSPMNYPPC-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C(OC)=CC1)C=C(C#N)C(=N2)C3=CC=CC=C3

Synonyms:

• 3-Quinolinecarbonitrile, 5,8-dimethoxy-2-phenyl-
• 5,8-Dimethoxy-2-phenyl-3-quinolinecarbonitrile