CymitQuimica logo

CAS 882748-26-7

:

1-(4-Chlorophenyl)-3-[[4-(1-methylpropyl)phenyl]amino]-1-propanone

Description:
1-(4-Chlorophenyl)-3-[[4-(1-methylpropyl)phenyl]amino]-1-propanone, identified by its CAS number 882748-26-7, is a synthetic organic compound characterized by its complex molecular structure. It features a propanone backbone with a chlorophenyl group and an amine-substituted phenyl group, which contribute to its unique chemical properties. This compound is typically classified as a ketone due to the presence of the carbonyl group (C=O) in its structure. The presence of the 4-chlorophenyl moiety may impart specific electronic and steric effects, influencing its reactivity and interactions with biological systems. Additionally, the branched alkyl group (1-methylpropyl) can enhance lipophilicity, potentially affecting its solubility and permeability in biological membranes. Such characteristics make it of interest in medicinal chemistry and pharmacology, where it may exhibit biological activity or serve as a precursor in the synthesis of other compounds. However, detailed studies on its specific applications, toxicity, and environmental impact would be necessary for a comprehensive understanding of its behavior and utility in various fields.
Formula:C19H22ClNO
InChI:InChI=1S/C19H22ClNO/c1-3-14(2)15-6-10-18(11-7-15)21-13-12-19(22)16-4-8-17(20)9-5-16/h4-11,14,21H,3,12-13H2,1-2H3
InChI key:InChIKey=ZNELYFACEQZSJZ-UHFFFAOYSA-N
SMILES:C(CCNC1=CC=C(C(CC)C)C=C1)(=O)C2=CC=C(Cl)C=C2
Synonyms:
  • 1-Propanone, 1-(4-chlorophenyl)-3-[[4-(1-methylpropyl)phenyl]amino]-
  • 1-(4-Chlorophenyl)-3-[[4-(1-methylpropyl)phenyl]amino]-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.