CAS 882748-66-5
:1-[1,1′-Biphenyl]-4-yl-3-[(4-cyclohexylphenyl)amino]-1-propanone
Description:
1-[1,1′-Biphenyl]-4-yl-3-[(4-cyclohexylphenyl)amino]-1-propanone, with the CAS number 882748-66-5, is an organic compound characterized by its complex structure, which includes a biphenyl moiety and an amine group attached to a propanone framework. This compound typically exhibits properties associated with organic ketones, such as being a solid at room temperature, with potential applications in organic synthesis and materials science. Its molecular structure suggests it may have interesting electronic properties due to the presence of aromatic rings, which can contribute to its stability and reactivity. Additionally, the cyclohexyl group may influence its solubility and interaction with biological systems, making it a candidate for studies in medicinal chemistry. The compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound represents a class of organic molecules that could be explored for various applications in pharmaceuticals and advanced materials.
Formula:C27H29NO
InChI:InChI=1S/C27H29NO/c29-27(25-13-11-23(12-14-25)21-7-3-1-4-8-21)19-20-28-26-17-15-24(16-18-26)22-9-5-2-6-10-22/h1,3-4,7-8,11-18,22,28H,2,5-6,9-10,19-20H2
InChI key:InChIKey=ZVTCPULKRAUZSS-UHFFFAOYSA-N
SMILES:C(CCNC1=CC=C(C=C1)C2CCCCC2)(=O)C3=CC=C(C=C3)C4=CC=CC=C4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.