CymitQuimica logo

CAS 882748-67-6

:

1-(4-Bromophenyl)-3-[(4-cyclohexylphenyl)amino]-1-propanone

Description:
1-(4-Bromophenyl)-3-[(4-cyclohexylphenyl)amino]-1-propanone, identified by its CAS number 882748-67-6, is an organic compound characterized by its complex structure, which includes a bromophenyl group and an amino-substituted cyclohexylphenyl moiety. This compound typically exhibits properties associated with ketones, such as being a solid at room temperature, with potential solubility in organic solvents. The presence of the bromine atom may impart unique reactivity and influence its electronic properties, while the cyclohexyl group can affect steric hindrance and molecular interactions. The compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. As with many organic compounds, safety precautions should be observed when handling this substance, given the potential hazards associated with brominated compounds and amines.
Formula:C21H24BrNO
InChI:InChI=1S/C21H24BrNO/c22-19-10-6-18(7-11-19)21(24)14-15-23-20-12-8-17(9-13-20)16-4-2-1-3-5-16/h6-13,16,23H,1-5,14-15H2
InChI key:InChIKey=VXOUNAPLHUEYBN-UHFFFAOYSA-N
SMILES:N(CCC(=O)C1=CC=C(Br)C=C1)C2=CC=C(C=C2)C3CCCCC3
Synonyms:
  • 1-(4-Bromophenyl)-3-[(4-cyclohexylphenyl)amino]-1-propanone
  • 1-Propanone, 1-(4-bromophenyl)-3-[(4-cyclohexylphenyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.