CAS 882748-68-7

1-(4-Chlorophenyl)-3-[(4-cyclohexylphenyl)amino]-1-propanone

Description:

1-(4-Chlorophenyl)-3-[(4-cyclohexylphenyl)amino]-1-propanone, identified by its CAS number 882748-68-7, is a synthetic organic compound characterized by its complex structure, which includes a propanone backbone substituted with a chlorophenyl group and an amino group linked to a cyclohexylphenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in pharmaceuticals and organic synthesis. It may display moderate to high lipophilicity due to the presence of the cyclohexyl and chlorophenyl groups, influencing its solubility in organic solvents. The presence of the amino group suggests potential for hydrogen bonding, which can affect its reactivity and interaction with biological targets. Additionally, the chlorophenyl substituent may impart specific electronic properties, potentially enhancing its biological activity. As with many organic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₂₁H₂₄ClNO

InChI: InChI=1S/C21H24ClNO/c22-19-10-6-18(7-11-19)21(24)14-15-23-20-12-8-17(9-13-20)16-4-2-1-3-5-16/h6-13,16,23H,1-5,14-15H2

InChI key: InChIKey=HFTMSHHHHOMLKS-UHFFFAOYSA-N

SMILES: N(CCC(=O)C1=CC=C(Cl)C=C1)C2=CC=C(C=C2)C3CCCCC3

Synonyms:

• 1-Propanone, 1-(4-chlorophenyl)-3-[(4-cyclohexylphenyl)amino]-
• 1-(4-Chlorophenyl)-3-[(4-cyclohexylphenyl)amino]-1-propanone