CAS 882748-70-1

3-[(4-Cyclohexylphenyl)amino]-1-(4-methoxyphenyl)-1-propanone

Description:

3-[(4-Cyclohexylphenyl)amino]-1-(4-methoxyphenyl)-1-propanone, identified by its CAS number 882748-70-1, is an organic compound characterized by its complex molecular structure, which includes an amine group, a ketone functional group, and aromatic rings. This compound typically exhibits properties associated with both amines and ketones, such as potential reactivity in nucleophilic substitution and electrophilic addition reactions. The presence of the cyclohexyl and methoxy substituents contributes to its hydrophobic characteristics, influencing its solubility in organic solvents rather than water. Additionally, the compound may display interesting photochemical properties, making it relevant in fields such as organic synthesis and materials science. Its structural features suggest potential applications in pharmaceuticals or as intermediates in organic reactions. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to the potential for toxicity or reactivity. Always refer to safety data sheets and relevant literature for detailed information on handling and applications.

Formula: C₂₂H₂₇NO₂

InChI: InChI=1S/C22H27NO2/c1-25-21-13-9-19(10-14-21)22(24)15-16-23-20-11-7-18(8-12-20)17-5-3-2-4-6-17/h7-14,17,23H,2-6,15-16H2,1H3

InChI key: InChIKey=MBGQSCWQGZYLAE-UHFFFAOYSA-N

SMILES: N(CCC(=O)C1=CC=C(OC)C=C1)C2=CC=C(C=C2)C3CCCCC3

Synonyms:

• 3-[(4-Cyclohexylphenyl)amino]-1-(4-methoxyphenyl)-1-propanone
• 1-Propanone, 3-[(4-cyclohexylphenyl)amino]-1-(4-methoxyphenyl)-