CymitQuimica logo

CAS 88276-83-9

:

3-(Triethoxysilyl)propanal

Description:
3-(Triethoxysilyl)propanal, with the CAS number 88276-83-9, is an organosilicon compound characterized by the presence of a triethoxysilyl group attached to a propanal moiety. This compound typically exhibits properties associated with both silanes and aldehydes, making it useful in various applications, particularly in surface modification and as a coupling agent in polymer chemistry. The triethoxysilyl group enhances its reactivity with silanol groups on silica surfaces, promoting adhesion and bonding in composite materials. Additionally, the aldehyde functional group can participate in further chemical reactions, such as condensation or polymerization, allowing for versatility in formulation. The compound is generally soluble in organic solvents and may exhibit hydrolytic stability, although it can react with moisture to form silanol and release ethanol. Its unique structure allows it to serve as a bridge between organic and inorganic materials, making it valuable in coatings, adhesives, and sealants, as well as in the development of hybrid organic-inorganic materials.
Formula:C9H20O4Si
InChI:InChI=1S/C9H20O4Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10/h8H,4-7,9H2,1-3H3
InChI key:InChIKey=MCALUCJIUQMFGC-UHFFFAOYSA-N
SMILES:[Si](CCC=O)(OCC)(OCC)OCC
Synonyms:
  • 3-(Triethoxysilyl)propanal
  • Propanal, 3-(triethoxysilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.