CAS 88276-93-1
:2-Methyl-3-(triethoxysilyl)propanal
Description:
2-Methyl-3-(triethoxysilyl)propanal, with the CAS number 88276-93-1, is an organosilicon compound characterized by the presence of both aldehyde and silane functional groups. This compound features a propanal backbone with a methyl group and a triethoxysilyl group attached, which enhances its reactivity and potential applications in various fields. The triethoxysilyl group allows for the formation of siloxane bonds, making it useful in surface modification, adhesion, and as a coupling agent in composite materials. The aldehyde functional group can participate in condensation reactions, enabling the formation of cross-linked networks. This compound is typically colorless to pale yellow and may have a characteristic odor due to the aldehyde group. It is soluble in organic solvents and can be hydrolyzed in the presence of moisture, leading to the release of ethanol and the formation of silanol species. Overall, 2-Methyl-3-(triethoxysilyl)propanal is valued for its versatility in enhancing the properties of materials in coatings, adhesives, and sealants.
Formula:C10H22O4Si
InChI:InChI=1S/C10H22O4Si/c1-5-12-15(13-6-2,14-7-3)9-10(4)8-11/h8,10H,5-7,9H2,1-4H3
InChI key:InChIKey=YQHQXNHQABNVNA-UHFFFAOYSA-N
SMILES:[Si](CC(C=O)C)(OCC)(OCC)OCC
Synonyms:- Propanal, 2-methyl-3-(triethoxysilyl)-
- 2-Methyl-3-(triethoxysilyl)propanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
