CAS 882767-85-3
:4-chloro-6-(3,4-dihydroquinolin-1(2H)-yl)pyrimidin-5-amine
Description:
4-Chloro-6-(3,4-dihydroquinolin-1(2H)-yl)pyrimidin-5-amine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with a chlorine atom and an amine group, as well as a dihydroquinoline moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the chloro group and the amine can influence its reactivity and interactions with biological targets. It may also participate in hydrogen bonding due to the amine functionality, which can enhance its pharmacological properties. The compound's molecular structure suggests potential applications in drug development, particularly in the fields of oncology or neurology, where pyrimidine derivatives are often explored for their therapeutic effects. As with many synthetic organic compounds, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species.
Formula:C13H13ClN4
InChI:InChI=1/C13H13ClN4/c14-12-11(15)13(17-8-16-12)18-7-3-5-9-4-1-2-6-10(9)18/h1-2,4,6,8H,3,5,7,15H2
Synonyms:- 4-chloro-6-(3,4-dihydro-2H-quinolin-1-yl)pyrimidin-5-amine
- 5-pyrimidinamine, 4-chloro-6-(3,4-dihydro-1(2H)-quinolinyl)-
- 4-Chloro-6-(3,4-dihydroquinolin-1(2H)-yl)pyrimidin-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-6-(3,4-dihydroquinolin-1(2H)-yl)pyrimidin-5-amine
CAS:Formula:C13H13ClN4Molecular weight:260.7221

