CAS 88279-12-3
:Benzamide, 2-azido-3,5-dichloro-N-phenyl-
Description:
Benzamide, 2-azido-3,5-dichloro-N-phenyl- is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) group. The specific structure includes azido (-N3) and dichloro substituents at the 2 and 3,5 positions of the benzene ring, respectively. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The azido group is known for its reactivity, particularly in click chemistry and other synthetic applications, while the dichloro substituents can influence the compound's electronic properties and reactivity. Due to the presence of both azido and chloro groups, this compound may also exhibit interesting biological activities and potential applications in medicinal chemistry. Safety precautions should be taken when handling this compound, as azides can be sensitive and potentially explosive under certain conditions.
Formula:C13H8Cl2N4O
InChI:InChI=1S/C13H8Cl2N4O/c14-8-6-10(12(18-19-16)11(15)7-8)13(20)17-9-4-2-1-3-5-9/h1-7H,(H,17,20)
InChI key:InChIKey=APJCSFOBLFVDHM-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2=C(N=[N+]=[N-])C(Cl)=CC(Cl)=C2
Synonyms:- 2-Azido-3,5-dichloro-N-phenylbenzamide
- Benzamide, 2-azido-3,5-dichloro-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
