
CAS 88280-81-3
:Octyl 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate
Description:
Octyl 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate, with the CAS number 88280-81-3, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance typically features a pyrimidine ring that is substituted with a carboxylate group and an octyl chain, contributing to its hydrophobic characteristics. The presence of the dioxo groups indicates that it has two carbonyl functionalities, which can influence its reactivity and potential applications in organic synthesis or as a pharmaceutical intermediate. The octyl group enhances its lipophilicity, making it more soluble in organic solvents than in water. This compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its structural features suggest potential uses in drug formulation or as a building block in the synthesis of more complex molecules. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety data should also be consulted to understand its handling and potential hazards.
Formula:C13H20N2O4
InChI:InChI=1S/C13H20N2O4/c1-2-3-4-5-6-7-8-19-12(17)10-9-11(16)15-13(18)14-10/h9H,2-8H2,1H3,(H2,14,15,16,18)
InChI key:InChIKey=JVCVWBZTXWYZSC-UHFFFAOYSA-N
SMILES:C(OCCCCCCCC)(=O)C1=CC(=O)NC(=O)N1
Synonyms:- 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, octyl ester
- Octyl 1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
