CAS 88281-14-5
:4-Hydroxy-2-(1-methylethylidene)-3(2H)-benzofuranone
Description:
4-Hydroxy-2-(1-methylethylidene)-3(2H)-benzofuranone, also known by its CAS number 88281-14-5, is an organic compound characterized by its unique structure that includes a benzofuranone moiety. This compound features a hydroxyl group and an isopropenyl substituent, which contribute to its reactivity and potential applications in various chemical processes. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. This compound is of interest in fields such as organic synthesis and materials science, where it may serve as an intermediate or a building block for more complex molecules. Additionally, its structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C11H10O3
InChI:InChI=1S/C11H10O3/c1-6(2)11-10(13)9-7(12)4-3-5-8(9)14-11/h3-5,12H,1-2H3
InChI key:InChIKey=LHUCBOXYOVDMGT-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC1=C(C)C)=CC=CC2O
Synonyms:- 3(2H)-Benzofuranone, 4-hydroxy-2-(1-methylethylidene)-
- 4-Hydroxy-2-(1-methylethylidene)-3(2H)-benzofuranone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
