CAS 88283-35-6
:1-(3,4-Dichlorophenyl)-2-(2-pyrazinyl)ethanone
Description:
1-(3,4-Dichlorophenyl)-2-(2-pyrazinyl)ethanone, with the CAS number 88283-35-6, is a chemical compound characterized by its unique structural features, which include a dichlorophenyl group and a pyrazinyl moiety. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. It is often studied for its potential biological activities, particularly in the fields of medicinal chemistry and pharmacology, where it may exhibit various effects due to its ability to interact with biological targets. The presence of the dichlorophenyl group can enhance lipophilicity, potentially influencing its bioavailability and pharmacokinetics. Additionally, the pyrazinyl ring may contribute to its reactivity and interaction with other chemical species. Safety data should be consulted for handling and usage, as compounds with halogenated aromatic systems can pose environmental and health risks. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and chemical research.
Formula:C12H8Cl2N2O
InChI:InChI=1S/C12H8Cl2N2O/c13-10-2-1-8(5-11(10)14)12(17)6-9-7-15-3-4-16-9/h1-5,7H,6H2
InChI key:InChIKey=FRGAQULCKRRZTG-UHFFFAOYSA-N
SMILES:C(CC=1C=NC=CN1)(=O)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 1-(3,4-Dichlorophenyl)-2-(2-pyrazinyl)ethanone
- Ethanone, 1-(3,4-dichlorophenyl)-2-pyrazinyl-
- 1-(3,4-Dichlorophenyl)-2-(pyrazin-2-yl)ethan-1-one
- Ethanone, 1-(3,4-dichlorophenyl)-2-(2-pyrazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
