CymitQuimica logo

CAS 88283-43-6

:

5,5-Dimethyl-3-[(trichloromethyl)thio]-2-thiazolidinone

Description:
5,5-Dimethyl-3-[(trichloromethyl)thio]-2-thiazolidinone is a heterocyclic compound characterized by its thiazolidinone structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound is notable for its trichloromethylthio group, which contributes to its reactivity and potential applications in various chemical processes. Typically, thiazolidinones exhibit biological activity, making them of interest in medicinal chemistry. The presence of the dimethyl groups enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. The trichloromethyl group is known for its ability to participate in nucleophilic substitution reactions, which can be leveraged in synthetic organic chemistry. Additionally, the compound may exhibit specific physical properties such as melting point and boiling point, which are essential for its handling and application in laboratory settings. Safety considerations are paramount due to the presence of chlorine atoms, which can pose health risks; thus, appropriate precautions should be taken when working with this substance.
Formula:C6H8Cl3NOS2
InChI:InChI=1S/C6H8Cl3NOS2/c1-5(2)3-10(4(11)12-5)13-6(7,8)9/h3H2,1-2H3
InChI key:InChIKey=SQJLEKFAOGSVIC-UHFFFAOYSA-N
SMILES:S(C(Cl)(Cl)Cl)N1CC(C)(C)SC1=O
Synonyms:
  • 2-Thiazolidinone, 5,5-dimethyl-3-[(trichloromethyl)thio]-
  • 5,5-Dimethyl-3-[(trichloromethyl)thio]-2-thiazolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.