CAS 88284-14-4
:2-Butoxy-3-quinolinecarboxylic acid
Description:
2-Butoxy-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a butoxy group, which is an alkoxy functional group derived from butanol, contributing to its solubility and reactivity. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of both the butoxy and carboxylic acid groups. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of the quinoline moiety may confer biological activity, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H15NO3
InChI:InChI=1S/C14H15NO3/c1-2-3-8-18-13-11(14(16)17)9-10-6-4-5-7-12(10)15-13/h4-7,9H,2-3,8H2,1H3,(H,16,17)
InChI key:InChIKey=ATKHOKWXTUCWGI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC2=C(N=C1OCCCC)C=CC=C2
Synonyms:- 3-Quinolinecarboxylic acid, 2-butoxy-
- 2-Butoxy-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
