CymitQuimica logo

CAS 88284-50-8

:

1(2H)-Naphthalenone, 6-(dimethylamino)-3,4-dihydro-, hydrochloride (1:1)

Description:
1(2H)-Naphthalenone, 6-(dimethylamino)-3,4-dihydro-, hydrochloride (1:1), with the CAS number 88284-50-8, is a chemical compound characterized by its naphthalenone structure, which features a fused aromatic ring system. This compound contains a dimethylamino group, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. The presence of the hydrochloride indicates that the compound is in a salt form, enhancing its solubility in water and making it more stable for various applications. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in organic synthesis or as pharmacological agents. The dihydro configuration suggests that the compound may have reduced aromatic character in certain positions, which can influence its reactivity and interaction with biological targets. Overall, this compound's unique structural features and functional groups make it of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C12H15NO·ClH
InChI:InChI=1S/C12H15NO.ClH/c1-13(2)10-6-7-11-9(8-10)4-3-5-12(11)14;/h6-8H,3-5H2,1-2H3;1H
InChI key:InChIKey=BFKONFLJBMKRLJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(N(C)C)=CC2)CCC1.Cl
Synonyms:
  • 1(2H)-Naphthalenone, 6-(dimethylamino)-3,4-dihydro-, hydrochloride
  • 1(2H)-Naphthalenone, 6-(dimethylamino)-3,4-dihydro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.