CymitQuimica logo

CAS 882847-07-6

:

Benzenepropanoic acid,4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-

Description:
Benzenepropanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- is a chemical compound characterized by its complex structure, which includes a benzene ring, a propanoic acid moiety, and a fluorenylmethoxycarbonyl (Fmoc) protecting group. The Fmoc group is commonly used in peptide synthesis to protect amino groups, indicating that this compound may play a role in the synthesis of peptides or related biomolecules. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit properties such as solubility in polar solvents. Additionally, the compound's structure may confer specific biological activities or interactions, making it of interest in medicinal chemistry and drug development. Its CAS number, 882847-07-6, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, highlighting its potential utility in synthetic applications.
Formula:C24H21NO4
InChI:InChI=1S/C24H21NO4/c26-23(27)14-11-16-9-12-17(13-10-16)25-24(28)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22H,11,14-15H2,(H,25,28)(H,26,27)
InChI key:KPJLWYDRVBUVDL-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CCC(=O)O
Synonyms:
  • 3-(Fmoc-4-Aminophenyl)-Propionic Acid
Found 5 products.