CAS 882847-07-6

Benzenepropanoic acid,4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-

Description:

Benzenepropanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- is a chemical compound characterized by its complex structure, which includes a benzene ring, a propanoic acid moiety, and a fluorenylmethoxycarbonyl (Fmoc) protecting group. The Fmoc group is commonly used in peptide synthesis to protect amino groups, indicating that this compound may play a role in the synthesis of peptides or related biomolecules. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit properties such as solubility in polar solvents. Additionally, the compound's structure may confer specific biological activities or interactions, making it of interest in medicinal chemistry and drug development. Its CAS number, 882847-07-6, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, highlighting its potential utility in synthetic applications.

Formula: C₂₄H₂₁NO₄

InChI: InChI=1S/C24H21NO4/c26-23(27)14-11-16-9-12-17(13-10-16)25-24(28)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22H,11,14-15H2,(H,25,28)(H,26,27)

InChI key: KPJLWYDRVBUVDL-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CCC(=O)O

Synonyms:

• 3-(Fmoc-4-Aminophenyl)-Propionic Acid

3-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid

CAS: 882847-07-6

3-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid

Formula: C₂₄H₂₁NO₄

Purity: 95%

Molecular weight: 387.44

Ref: 54-OR1051724

3-(4-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)Phenyl)Propanoic Acid

CAS: 882847-07-6

Formula: C₂₄H₂₁NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 387.4278

Ref: IN-DA008AHU

3-(4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid

CAS: 882847-07-6

3-(4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid is a PROTAC linker utilized in the synthesis of PROTAC molecules.

Formula: C₂₄H₂₁NO₄

Molecular weight: 387.4278

Ref: TM-T215647

3-(Fmoc-4-aminophenyl)propionic acid

CAS: 882847-07-6

3-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid

Formula: C₂₄H₂₁NO₄

Purity: 95%

Molecular weight: 387.43

Ref: IN-DG80687

3-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)propanoic acid

CAS: 882847-07-6

Formula: C₂₄H₂₁NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 387.435

Ref: 10-F325099