CAS 882847-24-7
:9H-Xanthene-4-propanoicacid, 5-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethyl]-
Description:
9H-Xanthene-4-propanoic acid, 5-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethyl]- is a complex organic compound characterized by its xanthene core, which is a polycyclic aromatic structure known for its fluorescent properties. The presence of a propanoic acid group indicates that it has carboxylic acid functionality, which can participate in various chemical reactions, including esterification and amidation. The fluorenylmethoxycarbonyl (Fmoc) group is commonly used in peptide synthesis as a protective group for amino acids, suggesting that this compound may be involved in bioconjugation or drug development applications. The compound's structure implies potential solubility in organic solvents, and it may exhibit interesting photophysical properties due to the conjugated systems present. Additionally, the presence of amino and carboxylic acid functionalities suggests that it could engage in hydrogen bonding and ionic interactions, influencing its reactivity and interactions in biological systems. Overall, this compound may serve as a valuable tool in synthetic chemistry and biochemistry.
Formula:C33H29NO5
InChI:InChI=1S/C33H29NO5/c35-30(36)16-15-21-7-5-9-23-19-24-10-6-8-22(32(24)39-31(21)23)17-18-34-33(37)38-20-29-27-13-3-1-11-25(27)26-12-2-4-14-28(26)29/h1-14,29H,15-20H2,(H,34,37)(H,35,36)
InChI key:InChIKey=BQYXKMWKYKHBSQ-UHFFFAOYSA-N
SMILES:C(OC(NCCC1=C2C(CC=3C(O2)=C(CCC(O)=O)C=CC3)=CC=C1)=O)C4C=5C(C=6C4=CC=CC6)=CC=CC5
Synonyms:- 4-(Fmoc-2-Aminoethyl)-6-Dibenzofuranpropionic Acid
- 5-[2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]ethyl]-9H-xanthene-4-propanoic acid
- 9H-Xanthene-4-propanoic acid, 5-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethyl]-
- Rarechem Em Wb 0034
- 4-(Fmoc-2-aminoethyl)-6-dibenzofuranpropionic acid≥ 98% (HPLC)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.