CymitQuimica logo

CAS 882856-60-2

:

6-chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazine

Description:
6-Chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazine is a heterocyclic compound characterized by its unique triazole and pyridazine ring structures. The presence of a chloro group and a trifluoromethyl group contributes to its chemical reactivity and potential applications in medicinal chemistry and agrochemicals. This compound typically exhibits properties such as moderate to high solubility in organic solvents, and its polar functional groups can influence its interaction with biological targets. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making such compounds of interest in drug design. Additionally, the triazole moiety can participate in hydrogen bonding and coordination with metal ions, which may be relevant in various catalytic and biological processes. Overall, the structural features of 6-chloro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazine suggest it may possess interesting pharmacological properties, warranting further investigation in the fields of medicinal chemistry and material science.
Formula:C6H2ClF3N4
InChI:InChI=1/C6H2ClF3N4/c7-3-1-2-4-11-5(6(8,9)10)13-14(4)12-3/h1-2H
SMILES:c1cc2nc(C(F)(F)F)nn2nc1Cl
Synonyms:
  • 6-Chloro-2-(trifluoromethyl)[1,2,4]triazolo[1,5-b]pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.