CAS 88297-78-3
:N-(1-Bromo-2-oxopropyl)benzamide
Description:
N-(1-Bromo-2-oxopropyl)benzamide is an organic compound characterized by its amide functional group, which is linked to a benzene ring and a bromo-substituted propanoyl moiety. The presence of the bromo group introduces significant reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The oxo group (carbonyl) contributes to the compound's polarity and can influence its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could participate in hydrogen bonding due to the amide group, affecting its physical properties such as melting and boiling points. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine atom and the aromatic benzene ring. Overall, N-(1-Bromo-2-oxopropyl)benzamide presents a unique combination of functional groups that can be exploited in synthetic chemistry and potential applications in pharmaceuticals.
Formula:C10H10BrNO2
InChI:InChI=1S/C10H10BrNO2/c1-7(13)9(11)12-10(14)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,14)
InChI key:InChIKey=NMLITCWUEYQGJG-UHFFFAOYSA-N
SMILES:C(NC(C(C)=O)Br)(=O)C1=CC=CC=C1
Synonyms:- Benzamide, N-(1-bromo-2-oxopropyl)-
- N-(1-Bromo-2-oxopropyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
