CAS 882980-86-1

Ethyl (2S)-2,3-dihydro-1,4-benzodioxin-2-carboxylate

Description:

Ethyl (2S)-2,3-dihydro-1,4-benzodioxin-2-carboxylate, with the CAS number 882980-86-1, is an organic compound characterized by its unique bicyclic structure that incorporates a benzodioxin moiety. This compound features a carboxylate ester functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ethyl group enhances its lipophilicity, making it more soluble in organic solvents. The stereochemistry indicated by the (2S) designation suggests that it has specific spatial arrangements that can influence its biological activity and interactions. Ethyl (2S)-2,3-dihydro-1,4-benzodioxin-2-carboxylate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of more complex molecules. Overall, this compound's structural features and functional groups position it as a valuable entity in chemical research and potential therapeutic applications.

Formula: C₁₁H₁₂O₄

InChI: InChI=1S/C11H12O4/c1-2-13-11(12)10-7-14-8-5-3-4-6-9(8)15-10/h3-6,10H,2,7H2,1H3/t10-/m0/s1

InChI key: InChIKey=DDIGEMWIKJMEIU-JTQLQIEISA-N

SMILES: C(OCC)(=O)[C@H]1OC=2C(OC1)=CC=CC2

Synonyms:

• Ethyl (2S)-2,3-dihydro-1,4-benzodioxin-2-carboxylate
• 1,4-Benzodioxin-2-carboxylic acid, 2,3-dihydro-, ethyl ester, (2S)-