CAS 883-80-7
:3-(1,1-Dimethylethyl)-1-methylnaphthalene
Description:
3-(1,1-Dimethylethyl)-1-methylnaphthalene, also known by its CAS number 883-80-7, is an organic compound belonging to the class of polycyclic aromatic hydrocarbons. It features a naphthalene backbone, which consists of two fused benzene rings, and is substituted with a tert-butyl group (1,1-dimethylethyl) and a methyl group. This compound is characterized by its hydrophobic nature, making it insoluble in water but soluble in organic solvents. It typically exhibits a high boiling point and moderate volatility due to its larger molecular structure. The presence of bulky substituents like the tert-butyl group influences its physical properties, such as melting point and density, and can affect its reactivity and interactions with other chemical species. 3-(1,1-Dimethylethyl)-1-methylnaphthalene is often studied for its potential applications in organic synthesis and as a chemical intermediate in various industrial processes. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C15H18
InChI:InChI=1/C15H18/c1-11-9-13(15(2,3)4)10-12-7-5-6-8-14(11)12/h5-10H,1-4H3
InChI key:InChIKey=IRMNGEAZYAGNMC-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(C(C)(C)C)C1)C=CC=C2
Synonyms:- 3-(tert-Butyl)-1-methylnaphthalene
- Naphthalene, 3-(1,1-dimethylethyl)-1-methyl-
- 3-tert-Butyl-1-methylnaphthalene
- Naphthalene, 3-tert-butyl-1-methyl-
- 3-(1,1-Dimethylethyl)-1-methylnaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
